From Wikipedia, the free encyclopedia
Strictinin
|
Names
|
IUPAC name
β-D-Glucopyranose 4,6-(4,4′,5,5′,6,6′-hexahydroxy[1,1′-biphenyl]-2,2′-dicarboxylate) 1-(3,4,5-trihydroxybenzoate)
|
Systematic IUPAC name
(11aR,13S,14R,15R,15aS)-2,3,4,5,6,7,14,15-Octahydroxy-9,17-dioxo-9,11,11a,13,14,15,15a,17-octahydrodibenzo[g,i]pyrano[3,2-b][1,5]dioxacycloundecin-13-yl 3,4,5-trihydroxybenzoate
|
Identifiers
|
|
|
|
|
ChemSpider
|
|
|
|
|
|
InChI=1S/C27H22O18/c28-9-1-6(2-10(29)16(9)32)24(39)45-27-22(38)21(37)23-13(43-27)5-42-25(40)7-3-11(30)17(33)19(35)14(7)15-8(26(41)44-23)4-12(31)18(34)20(15)36/h1-4,13,21-23,27-38H,5H2/t13-,21-,22-,23-,27+/m1/s1 Key: FYIJLTSMNXUNLT-CXQFPWCTSA-N InChI=1/C27H22O18/c28-9-1-6(2-10(29)16(9)32)24(39)45-27-22(38)21(37)23-13(43-27)5-42-25(40)7-3-11(30)17(33)19(35)14(7)15-8(26(41)44-23)4-12(31)18(34)20(15)36/h1-4,13,21-23,27-38H,5H2/t13-,21-,22-,23-,27+/m1/s1 Key: FYIJLTSMNXUNLT-CXQFPWCTBJ
|
C1[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)OC(=O)C3=CC(=C(C(=C3)O)O)O)O)O)OC(=O)C4=CC(=C(C(=C4C5=C(C(=C(C=C5C(=O)O1)O)O)O)O)O)O
|
Properties
|
|
C27H22O18
|
Molar mass
|
634.455 g·mol−1
|
Except where otherwise noted, data are given for materials in their standard state (at 25 °C [77 °F], 100 kPa).
|
Chemical compound
Strictinin is a bioactive chemical of the ellagitannin family of hydrolyzable tannins. This compound shows activity against influenza virus.[1]
References[edit]
- ^ Saha, Repon Kumer; Takahashi, Tadanobu; Kurebayashi, Yuuki; Fukushima, Keijo; Minami, Akira; Kinbara, Noriaki; Ichitani, Masaki; Sagesaka, Yuko M.; Suzuki, Takashi (October 2010). "Antiviral effect of strictinin on influenza virus replication". Antiviral Res. 88 (1): 10–8. doi:10.1016/j.antiviral.2010.06.008. PMID 20615432.
|
---|
Moieties | |
---|
Lactones | |
---|
Monomers |
- Acetonyl geraniin
- Alnusiin
- Bicornin
- Carlesiin
- Casuarictin
- Emblicanin A and B
- Euscaphinin
- Galloyl pedunculagin
- Grandinin
- Helioscopinin B
- Jolkinin
- Lagerstannin A, B and C
- Macranganin
- Myrobalanitannin
- Nupharin A, B, C, D, E and F
- Pedunculagin
- Punicalagin
- Punigluconin
- Phyllanemblinin A, B, C, D, E and F
- Punicalin
- Roburin E
- Rugosin E
- Sanguiin H-5
- Stenophyllanin A, B and C
- Strictinin
- Tellimagrandin I and II
- Teracatain
- Terchebulin
- Terflavin A and B
- Tergallic acid
- Tergallic acid dilactone
|
---|
Oligomers | |
---|
Other | |
---|